C11H15ClN2S2 — CID 105249146
[(2-chlorophenyl)-(1,4-dithian-2-yl)methyl]hydrazine (PubChem CID 105249146) has the molecular formula C11H15ClN2S2 and a molecular weight of 274.84 g/mol. Its IUPAC name is [(2-chlorophenyl)-(1,4-dithian-2-yl)methyl]hydrazine.
| Compound Name | [(2-chlorophenyl)-(1,4-dithian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249146 |
| Molecular Formula | C11H15ClN2S2 |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | [(2-chlorophenyl)-(1,4-dithian-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ccccc1Cl)C1CSCCS1 |
| InChI | InChI=1S/C11H15ClN2S2/c12-9-4-2-1-3-8(9)11(14-13)10-7-15-5-6-16-10/h1-4,10-11,14H,5-7,13H2 |
| InChIKey | VYNYVZAAZKCFFR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|