C16H19NS2 — CID 79966450
1-(1,4-dithian-2-yl)-N-methyl-1-naphthalen-1-ylmethanamine (PubChem CID 79966450) has the molecular formula C16H19NS2 and a molecular weight of 289.47 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-methyl-1-naphthalen-1-ylmethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-methyl-1-naphthalen-1-ylmethanamine |
|---|---|
| PubChem CID | 79966450 |
| Molecular Formula | C16H19NS2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-methyl-1-naphthalen-1-ylmethanamine |
| SMILES | CNC(c1cccc2ccccc12)C1CSCCS1 |
| InChI | InChI=1S/C16H19NS2/c1-17-16(15-11-18-9-10-19-15)14-8-4-6-12-5-2-3-7-13(12)14/h2-8,15-17H,9-11H2,1H3 |
| InChIKey | SETMEJUNMDWYOX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |