C15H16OS2 — CID 79973039
1,4-dithian-2-yl(naphthalen-1-yl)methanol (PubChem CID 79973039) has the molecular formula C15H16OS2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1,4-dithian-2-yl(naphthalen-1-yl)methanol.
| Compound Name | 1,4-dithian-2-yl(naphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 79973039 |
| Molecular Formula | C15H16OS2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1,4-dithian-2-yl(naphthalen-1-yl)methanol |
| SMILES | OC(c1cccc2ccccc12)C1CSCCS1 |
| InChI | InChI=1S/C15H16OS2/c16-15(14-10-17-8-9-18-14)13-7-3-5-11-4-1-2-6-12(11)13/h1-7,14-16H,8-10H2 |
| InChIKey | KGQDMYXXMAEVFZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |