C15H15NOS2 — CID 112762776
N-naphthalen-1-yl-1,4-dithiane-2-carboxamide (PubChem CID 112762776) has the molecular formula C15H15NOS2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-naphthalen-1-yl-1,4-dithiane-2-carboxamide.
| Compound Name | N-naphthalen-1-yl-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112762776 |
| Molecular Formula | C15H15NOS2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-naphthalen-1-yl-1,4-dithiane-2-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)C1CSCCS1 |
| InChI | InChI=1S/C15H15NOS2/c17-15(14-10-18-8-9-19-14)16-13-7-3-5-11-4-1-2-6-12(11)13/h1-7,14H,8-10H2,(H,16,17) |
| InChIKey | BDXAACYEGYZKQG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |