C18H16NO3- — CID 6944652
(1R,6S)-6-(naphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 6944652) has the molecular formula C18H16NO3- and a molecular weight of 294.33 g/mol. Its IUPAC name is (1R,6S)-6-(naphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-(naphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6944652 |
| Molecular Formula | C18H16NO3- |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1R,6S)-6-(naphthalen-1-ylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(Nc1cccc2ccccc12)[C@H]1CC=CC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C18H17NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h1-8,11,14-15H,9-10H2,(H,19,20)(H,21,22)/p-1/t14-,15+/m0/s1 |
| InChIKey | VALUSFBVAXMEGU-LSDHHAIUSA-M |
| XLogP | 2.11 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|