C22H21N2O4- — CID 78429350
6-[[2-(benzylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 78429350) has the molecular formula C22H21N2O4- and a molecular weight of 377.42 g/mol. Its IUPAC name is 6-[[2-(benzylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[[2-(benzylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 78429350 |
| Molecular Formula | C22H21N2O4- |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 6-[[2-(benzylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(NCc1ccccc1)c1ccccc1NC(=O)C1CC=CCC1C(=O)[O-] |
| InChI | InChI=1S/C22H22N2O4/c25-20(23-14-15-8-2-1-3-9-15)18-12-6-7-13-19(18)24-21(26)16-10-4-5-11-17(16)22(27)28/h1-9,12-13,16-17H,10-11,14H2,(H,23,25)(H,24,26)(H,27,28)/p-1 |
| InChIKey | PGHBWNIFUFUOMK-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|