C24H25N2O4- — CID 6958236
(1R,6R)-6-[[2-[(4-propan-2-ylphenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6958236) has the molecular formula C24H25N2O4- and a molecular weight of 405.47 g/mol. Its IUPAC name is (1R,6R)-6-[[2-[(4-propan-2-ylphenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6R)-6-[[2-[(4-propan-2-ylphenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6958236 |
| Molecular Formula | C24H25N2O4- |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (1R,6R)-6-[[2-[(4-propan-2-ylphenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)c1ccc(NC(=O)c2ccccc2NC(=O)[C@@H]2CC=CC[C@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-15(2)16-11-13-17(14-12-16)25-23(28)20-9-5-6-10-21(20)26-22(27)18-7-3-4-8-19(18)24(29)30/h3-6,9-15,18-19H,7-8H2,1-2H3,(H,25,28)(H,26,27)(H,29,30)/p-1/t18-,19-/m1/s1 |
| InChIKey | OOQFCMGZQKECHQ-RTBURBONSA-M |
| XLogP | 3.33 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|