C21H17Cl2N2O4- — CID 6975293
(1S,6R)-6-[[2-[(2,3-dichlorophenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6975293) has the molecular formula C21H17Cl2N2O4- and a molecular weight of 432.28 g/mol. Its IUPAC name is (1S,6R)-6-[[2-[(2,3-dichlorophenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[[2-[(2,3-dichlorophenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6975293 |
| Molecular Formula | C21H17Cl2N2O4- |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | (1S,6R)-6-[[2-[(2,3-dichlorophenyl)carbamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccccc1NC(=O)[C@@H]1CC=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C21H18Cl2N2O4/c22-15-9-5-11-17(18(15)23)25-20(27)14-8-3-4-10-16(14)24-19(26)12-6-1-2-7-13(12)21(28)29/h1-5,8-13H,6-7H2,(H,24,26)(H,25,27)(H,28,29)/p-1/t12-,13+/m1/s1 |
| InChIKey | AUVJSPNSTYUXKM-OLZOCXBDSA-M |
| XLogP | 3.52 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|