C17H20NO3- — CID 6953281
(1S,6R)-6-[(2-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6953281) has the molecular formula C17H20NO3- and a molecular weight of 286.35 g/mol. Its IUPAC name is (1S,6R)-6-[(2-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[(2-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6953281 |
| Molecular Formula | C17H20NO3- |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1S,6R)-6-[(2-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)c1ccccc1NC(=O)[C@@H]1CC=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C17H21NO3/c1-11(2)12-7-5-6-10-15(12)18-16(19)13-8-3-4-9-14(13)17(20)21/h3-7,10-11,13-14H,8-9H2,1-2H3,(H,18,19)(H,20,21)/p-1/t13-,14+/m1/s1 |
| InChIKey | LNXOLIRHXMVUSL-KGLIPLIRSA-M |
| XLogP | 2.08 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|