C16H15NO5-2 — CID 6936152
3-[[(1R,6S)-6-carboxylatocyclohex-3-ene-1-carbonyl]amino]-4-methylbenzoate (PubChem CID 6936152) has the molecular formula C16H15NO5-2 and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-[[(1R,6S)-6-carboxylatocyclohex-3-ene-1-carbonyl]amino]-4-methylbenzoate.
| Compound Name | 3-[[(1R,6S)-6-carboxylatocyclohex-3-ene-1-carbonyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 6936152 |
| Molecular Formula | C16H15NO5-2 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-[[(1R,6S)-6-carboxylatocyclohex-3-ene-1-carbonyl]amino]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1NC(=O)[C@@H]1CC=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C16H17NO5/c1-9-6-7-10(15(19)20)8-13(9)17-14(18)11-4-2-3-5-12(11)16(21)22/h2-3,6-8,11-12H,4-5H2,1H3,(H,17,18)(H,19,20)(H,21,22)/p-2/t11-,12+/m1/s1 |
| InChIKey | GKIJHFZQSITLDG-NEPJUHHUSA-L |
| XLogP | -0.37 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|