C15H15BrNO3- — CID 6950935
(1S,6S)-6-[(4-bromo-2-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6950935) has the molecular formula C15H15BrNO3- and a molecular weight of 337.19 g/mol. Its IUPAC name is (1S,6S)-6-[(4-bromo-2-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[(4-bromo-2-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6950935 |
| Molecular Formula | C15H15BrNO3- |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | (1S,6S)-6-[(4-bromo-2-methylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1cc(Br)ccc1NC(=O)[C@H]1CC=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C15H16BrNO3/c1-9-8-10(16)6-7-13(9)17-14(18)11-4-2-3-5-12(11)15(19)20/h2-3,6-8,11-12H,4-5H2,1H3,(H,17,18)(H,19,20)/p-1/t11-,12-/m0/s1 |
| InChIKey | GWFKHFDHMIPHDJ-RYUDHWBXSA-M |
| XLogP | 2.03 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|