C23H23N2O4- — CID 6980110
(1R,6S)-6-[[3-methyl-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6980110) has the molecular formula C23H23N2O4- and a molecular weight of 391.45 g/mol. Its IUPAC name is (1R,6S)-6-[[3-methyl-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-[[3-methyl-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6980110 |
| Molecular Formula | C23H23N2O4- |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (1R,6S)-6-[[3-methyl-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1cc(NC(=O)[C@H]2CC=CC[C@H]2C(=O)[O-])ccc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c1-15-13-17(24-22(27)18-9-5-6-10-19(18)23(28)29)11-12-20(15)25-21(26)14-16-7-3-2-4-8-16/h2-8,11-13,18-19H,9-10,14H2,1H3,(H,24,27)(H,25,26)(H,28,29)/p-1/t18-,19+/m0/s1 |
| InChIKey | BWBFUCPMXHJMIZ-RBUKOAKNSA-M |
| XLogP | 2.45 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|