C15H13NO6-2 — CID 54704486
6-[(4-carboxy-3-oxidophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 54704486) has the molecular formula C15H13NO6-2 and a molecular weight of 303.27 g/mol. Its IUPAC name is 6-[(4-carboxy-3-oxidophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[(4-carboxy-3-oxidophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 54704486 |
| Molecular Formula | C15H13NO6-2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 6-[(4-carboxy-3-oxidophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(O)c1ccc(NC(=O)C2CC=CCC2C(=O)[O-])cc1[O-] |
| InChI | InChI=1S/C15H15NO6/c17-12-7-8(5-6-11(12)15(21)22)16-13(18)9-3-1-2-4-10(9)14(19)20/h1-2,5-7,9-10,17H,3-4H2,(H,16,18)(H,19,20)(H,21,22)/p-2 |
| InChIKey | ARAOHCKDOBBGLE-UHFFFAOYSA-L |
| XLogP | -0.27 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|