C15H16NO5- — CID 8893564
(1R,6R)-6-[(3-hydroxy-4-methoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 8893564) has the molecular formula C15H16NO5- and a molecular weight of 290.30 g/mol. Its IUPAC name is (1R,6R)-6-[(3-hydroxy-4-methoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6R)-6-[(3-hydroxy-4-methoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 8893564 |
| Molecular Formula | C15H16NO5- |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (1R,6R)-6-[(3-hydroxy-4-methoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC=CC[C@H]2C(=O)[O-])cc1O |
| InChI | InChI=1S/C15H17NO5/c1-21-13-7-6-9(8-12(13)17)16-14(18)10-4-2-3-5-11(10)15(19)20/h2-3,6-8,10-11,17H,4-5H2,1H3,(H,16,18)(H,19,20)/p-1/t10-,11-/m1/s1 |
| InChIKey | GZVLBQLUCCIMPX-GHMZBOCLSA-M |
| XLogP | 0.67 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|