C14H13ClNO3- — CID 7058222
(1S,6S)-6-[(2-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7058222) has the molecular formula C14H13ClNO3- and a molecular weight of 278.71 g/mol. Its IUPAC name is (1S,6S)-6-[(2-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[(2-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7058222 |
| Molecular Formula | C14H13ClNO3- |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (1S,6S)-6-[(2-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CC=CC[C@@H]1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H14ClNO3/c15-11-7-3-4-8-12(11)16-13(17)9-5-1-2-6-10(9)14(18)19/h1-4,7-10H,5-6H2,(H,16,17)(H,18,19)/p-1/t9-,10-/m0/s1 |
| InChIKey | VFJSZKPJLPFCFG-UWVGGRQHSA-M |
| XLogP | 1.61 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|