C20H19ClN2O2 — CID 18824632
2-N-(2-chlorophenyl)-1-N-phenylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 18824632) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-N-(2-chlorophenyl)-1-N-phenylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 2-N-(2-chlorophenyl)-1-N-phenylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 18824632 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-N-(2-chlorophenyl)-1-N-phenylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1CC=CCC1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H19ClN2O2/c21-17-12-6-7-13-18(17)23-20(25)16-11-5-4-10-15(16)19(24)22-14-8-2-1-3-9-14/h1-9,12-13,15-16H,10-11H2,(H,22,24)(H,23,25) |
| InChIKey | RRDULYMJRQATBZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|