C21H23ClN2O2 — CID 109142602
2-N-(4-tert-butylphenyl)-1-N-(2-chlorophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109142602) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 2-N-(4-tert-butylphenyl)-1-N-(2-chlorophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-(4-tert-butylphenyl)-1-N-(2-chlorophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109142602 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-N-(4-tert-butylphenyl)-1-N-(2-chlorophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C2CC2C(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O2/c1-21(2,3)13-8-10-14(11-9-13)23-19(25)15-12-16(15)20(26)24-18-7-5-4-6-17(18)22/h4-11,15-16H,12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | VEPBTEOFHIXYIT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |