C10H10ClNO — CID 849222
N-(2-chlorophenyl)cyclopropanecarboxamide (PubChem CID 849222) has the molecular formula C10H10ClNO and a molecular weight of 195.65 g/mol. Its IUPAC name is N-(2-chlorophenyl)cyclopropanecarboxamide.
| Compound Name | N-(2-chlorophenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 849222 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-(2-chlorophenyl)cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C10H10ClNO/c11-8-3-1-2-4-9(8)12-10(13)7-5-6-7/h1-4,7H,5-6H2,(H,12,13) |
| InChIKey | GYCVFBXOHKLFHE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |