C13H15Cl2NO2 — CID 112524536
N-(2,3-dichlorophenyl)-4-hydroxycyclohexane-1-carboxamide (PubChem CID 112524536) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-hydroxycyclohexane-1-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 112524536 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-hydroxycyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)C1CCC(O)CC1 |
| InChI | InChI=1S/C13H15Cl2NO2/c14-10-2-1-3-11(12(10)15)16-13(18)8-4-6-9(17)7-5-8/h1-3,8-9,17H,4-7H2,(H,16,18) |
| InChIKey | VLMKVLSAMIKTTI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |