C11H11Cl2NO2 — CID 3155144
N-(2,3-dichlorophenyl)oxolane-2-carboxamide (PubChem CID 3155144) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)oxolane-2-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 3155144 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)C1CCCO1 |
| InChI | InChI=1S/C11H11Cl2NO2/c12-7-3-1-4-8(10(7)13)14-11(15)9-5-2-6-16-9/h1,3-4,9H,2,5-6H2,(H,14,15) |
| InChIKey | UWIPRCHFJKJJJN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |