C11H11BrClNO2 — CID 103479904
(2S)-N-(2-bromo-3-chlorophenyl)oxolane-2-carboxamide (PubChem CID 103479904) has the molecular formula C11H11BrClNO2 and a molecular weight of 304.57 g/mol. Its IUPAC name is (2S)-N-(2-bromo-3-chlorophenyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-(2-bromo-3-chlorophenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 103479904 |
| Molecular Formula | C11H11BrClNO2 |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | (2S)-N-(2-bromo-3-chlorophenyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Br)[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H11BrClNO2/c12-10-7(13)3-1-4-8(10)14-11(15)9-5-2-6-16-9/h1,3-4,9H,2,5-6H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | SGXANZFQUQDNGL-VIFPVBQESA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |