C10H11ClN2O2 — CID 4166852
N-(2-chloro-3-pyridinyl)oxolane-2-carboxamide (PubChem CID 4166852) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)oxolane-2-carboxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 4166852 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)C1CCCO1 |
| InChI | InChI=1S/C10H11ClN2O2/c11-9-7(3-1-5-12-9)13-10(14)8-4-2-6-15-8/h1,3,5,8H,2,4,6H2,(H,13,14) |
| InChIKey | LYXSOXQHIFFCFI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|