C20H28N2O4 — CID 58409794
(2S)-N-[2-tert-butyl-3-[[(2S)-oxolane-2-carbonyl]amino]phenyl]oxolane-2-carboxamide (PubChem CID 58409794) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S)-N-[2-tert-butyl-3-[[(2S)-oxolane-2-carbonyl]amino]phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[2-tert-butyl-3-[[(2S)-oxolane-2-carbonyl]amino]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 58409794 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S)-N-[2-tert-butyl-3-[[(2S)-oxolane-2-carbonyl]amino]phenyl]oxolane-2-carboxamide |
| SMILES | CC(C)(C)c1c(NC(=O)[C@@H]2CCCO2)cccc1NC(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H28N2O4/c1-20(2,3)17-13(21-18(23)15-9-5-11-25-15)7-4-8-14(17)22-19(24)16-10-6-12-26-16/h4,7-8,15-16H,5-6,9-12H2,1-3H3,(H,21,23)(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | COOVQKMPUDDRQB-HOTGVXAUSA-N |
| XLogP | 3.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |