C18H16Cl2N2O3 — CID 43049586
N-[3-[(2,3-dichlorophenyl)carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 43049586) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-[3-[(2,3-dichlorophenyl)carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[(2,3-dichlorophenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 43049586 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-[3-[(2,3-dichlorophenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c19-13-6-2-7-14(16(13)20)22-17(23)11-4-1-5-12(10-11)21-18(24)15-8-3-9-25-15/h1-2,4-7,10,15H,3,8-9H2,(H,21,24)(H,22,23) |
| InChIKey | CTSWCBRRMZLNAI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |