C11H12INO2 — CID 42904469
N-(3-iodophenyl)oxolane-2-carboxamide (PubChem CID 42904469) has the molecular formula C11H12INO2 and a molecular weight of 317.13 g/mol. Its IUPAC name is N-(3-iodophenyl)oxolane-2-carboxamide.
| Compound Name | N-(3-iodophenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 42904469 |
| Molecular Formula | C11H12INO2 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | N-(3-iodophenyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)C1CCCO1 |
| InChI | InChI=1S/C11H12INO2/c12-8-3-1-4-9(7-8)13-11(14)10-5-2-6-15-10/h1,3-4,7,10H,2,5-6H2,(H,13,14) |
| InChIKey | GLOVCNFMIXBEOG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|