C18H17IN2O3 — CID 31700256
(2S)-N-[3-[(2-iodophenyl)carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 31700256) has the molecular formula C18H17IN2O3 and a molecular weight of 436.25 g/mol. Its IUPAC name is (2S)-N-[3-[(2-iodophenyl)carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2-iodophenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 31700256 |
| Molecular Formula | C18H17IN2O3 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | (2S)-N-[3-[(2-iodophenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1I)c1cccc(NC(=O)[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H17IN2O3/c19-14-7-1-2-8-15(14)21-17(22)12-5-3-6-13(11-12)20-18(23)16-9-4-10-24-16/h1-3,5-8,11,16H,4,9-10H2,(H,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | AYGFDGXLXXZGIY-INIZCTEOSA-N |
| XLogP | 3.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|