C20H18N2O3 — CID 42884379
N-[3-[(3-ethynylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 42884379) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[3-[(3-ethynylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[(3-ethynylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 42884379 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[3-[(3-ethynylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cccc(NC(=O)C3CCCO3)c2)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-2-14-6-3-8-16(12-14)21-19(23)15-7-4-9-17(13-15)22-20(24)18-10-5-11-25-18/h1,3-4,6-9,12-13,18H,5,10-11H2,(H,21,23)(H,22,24) |
| InChIKey | AWQFEKBRPWSPDH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|