C28H24N2O5 — CID 46541035
methyl 3-[2-[3-[[3-(oxolane-2-carbonylamino)benzoyl]amino]phenyl]ethynyl]benzoate (PubChem CID 46541035) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is methyl 3-[2-[3-[[3-(oxolane-2-carbonylamino)benzoyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[3-(oxolane-2-carbonylamino)benzoyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 46541035 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | methyl 3-[2-[3-[[3-(oxolane-2-carbonylamino)benzoyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)c3cccc(NC(=O)C4CCCO4)c3)c2)c1 |
| InChI | InChI=1S/C28H24N2O5/c1-34-28(33)22-9-2-6-19(16-22)13-14-20-7-3-10-23(17-20)29-26(31)21-8-4-11-24(18-21)30-27(32)25-12-5-15-35-25/h2-4,6-11,16-18,25H,5,12,15H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | SIVZMOUNSNXEKY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|