C25H19NO5 — CID 55758820
methyl 3-[2-[3-[(3-methoxycarbonylbenzoyl)amino]phenyl]ethynyl]benzoate (PubChem CID 55758820) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 3-[2-[3-[(3-methoxycarbonylbenzoyl)amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[(3-methoxycarbonylbenzoyl)amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 55758820 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | methyl 3-[2-[3-[(3-methoxycarbonylbenzoyl)amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)c3cccc(C(=O)OC)c3)c2)c1 |
| InChI | InChI=1S/C25H19NO5/c1-30-24(28)20-9-3-6-17(14-20)12-13-18-7-4-11-22(15-18)26-23(27)19-8-5-10-21(16-19)25(29)31-2/h3-11,14-16H,1-2H3,(H,26,27) |
| InChIKey | RBQOLZIWIQNQOS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|