C24H18FNO3 — CID 18283964
methyl 3-[2-[3-[[2-(3-fluorophenyl)acetyl]amino]phenyl]ethynyl]benzoate (PubChem CID 18283964) has the molecular formula C24H18FNO3 and a molecular weight of 387.41 g/mol. Its IUPAC name is methyl 3-[2-[3-[[2-(3-fluorophenyl)acetyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[2-(3-fluorophenyl)acetyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 18283964 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 3-[2-[3-[[2-(3-fluorophenyl)acetyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)Cc3cccc(F)c3)c2)c1 |
| InChI | InChI=1S/C24H18FNO3/c1-29-24(28)20-8-2-5-17(13-20)11-12-18-6-4-10-22(15-18)26-23(27)16-19-7-3-9-21(25)14-19/h2-10,13-15H,16H2,1H3,(H,26,27) |
| InChIKey | QOXAVQMDRTWASD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|