C24H18FNO4 — CID 18288418
methyl 3-[2-[3-[[2-(4-fluorophenoxy)acetyl]amino]phenyl]ethynyl]benzoate (PubChem CID 18288418) has the molecular formula C24H18FNO4 and a molecular weight of 403.41 g/mol. Its IUPAC name is methyl 3-[2-[3-[[2-(4-fluorophenoxy)acetyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[2-(4-fluorophenoxy)acetyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 18288418 |
| Molecular Formula | C24H18FNO4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | methyl 3-[2-[3-[[2-(4-fluorophenoxy)acetyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)COc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C24H18FNO4/c1-29-24(28)19-6-2-4-17(14-19)8-9-18-5-3-7-21(15-18)26-23(27)16-30-22-12-10-20(25)11-13-22/h2-7,10-15H,16H2,1H3,(H,26,27) |
| InChIKey | RPVQXIMCNGSPOG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|