C26H23FN2O4 — CID 55740061
methyl 3-[2-[3-[[2-(2-fluorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]ethynyl]benzoate (PubChem CID 55740061) has the molecular formula C26H23FN2O4 and a molecular weight of 446.48 g/mol. Its IUPAC name is methyl 3-[2-[3-[[2-(2-fluorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[2-(2-fluorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 55740061 |
| Molecular Formula | C26H23FN2O4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 3-[2-[3-[[2-(2-fluorophenoxy)ethyl-methylcarbamoyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)N(C)CCOc3ccccc3F)c2)c1 |
| InChI | InChI=1S/C26H23FN2O4/c1-29(15-16-33-24-12-4-3-11-23(24)27)26(31)28-22-10-6-8-20(18-22)14-13-19-7-5-9-21(17-19)25(30)32-2/h3-12,17-18H,15-16H2,1-2H3,(H,28,31) |
| InChIKey | YSMCEAPUMXYFKN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|