C25H18N2O4 — CID 18204444
methyl 3-[2-[3-[[2-(2-cyanophenoxy)acetyl]amino]phenyl]ethynyl]benzoate (PubChem CID 18204444) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl 3-[2-[3-[[2-(2-cyanophenoxy)acetyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[2-(2-cyanophenoxy)acetyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 18204444 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | methyl 3-[2-[3-[[2-(2-cyanophenoxy)acetyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)COc3ccccc3C#N)c2)c1 |
| InChI | InChI=1S/C25H18N2O4/c1-30-25(29)20-9-4-6-18(14-20)12-13-19-7-5-10-22(15-19)27-24(28)17-31-23-11-3-2-8-21(23)16-26/h2-11,14-15H,17H2,1H3,(H,27,28) |
| InChIKey | SHGQJUZKJXTRJT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|