C18H22N2O4 — CID 51328279
1-[2-(4-methoxyphenoxy)ethyl]-3-(3-methoxyphenyl)-1-methylurea (PubChem CID 51328279) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)ethyl]-3-(3-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[2-(4-methoxyphenoxy)ethyl]-3-(3-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 51328279 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)ethyl]-3-(3-methoxyphenyl)-1-methylurea |
| SMILES | COc1ccc(OCCN(C)C(=O)Nc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-20(11-12-24-16-9-7-15(22-2)8-10-16)18(21)19-14-5-4-6-17(13-14)23-3/h4-10,13H,11-12H2,1-3H3,(H,19,21) |
| InChIKey | BQGHNBNUOSBFRQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |