C18H21N3O4 — CID 9225229
3-(carbamoylamino)-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide (PubChem CID 9225229) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide.
| Compound Name | 3-(carbamoylamino)-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 9225229 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-(carbamoylamino)-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide |
| SMILES | COc1ccc(OCCN(C)C(=O)c2cccc(NC(N)=O)c2)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-21(10-11-25-16-8-6-15(24-2)7-9-16)17(22)13-4-3-5-14(12-13)20-18(19)23/h3-9,12H,10-11H2,1-2H3,(H3,19,20,23) |
| InChIKey | XKRCSETZAOHJOH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |