C21H27N3O4 — CID 47067365
N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-3-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 47067365) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-3-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-3-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 47067365 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-3-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | COc1ccccc1OCCN(C)C(=O)c1cccc(NC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-15(2)22-21(26)23-17-9-7-8-16(14-17)20(25)24(3)12-13-28-19-11-6-5-10-18(19)27-4/h5-11,14-15H,12-13H2,1-4H3,(H2,22,23,26) |
| InChIKey | FXKVRPYEBDXBRZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |