C14H22N2O4 — CID 108869156
1,1-bis(2-methoxyethyl)-3-(3-methoxyphenyl)urea (PubChem CID 108869156) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1,1-bis(2-methoxyethyl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 108869156 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-3-(3-methoxyphenyl)urea |
| SMILES | COCCN(CCOC)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-18-9-7-16(8-10-19-2)14(17)15-12-5-4-6-13(11-12)20-3/h4-6,11H,7-10H2,1-3H3,(H,15,17) |
| InChIKey | KTWDWKNJEUXRGQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |