C20H26N2O7S — CID 3611617
[3-[[(3,5-dimethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3611617) has the molecular formula C20H26N2O7S and a molecular weight of 438.50 g/mol. Its IUPAC name is [3-[[(3,5-dimethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[(3,5-dimethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3611617 |
| Molecular Formula | C20H26N2O7S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [3-[[(3,5-dimethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1cccc(OS(C)(=O)=O)c1)C(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C20H26N2O7S/c1-26-9-8-22(14-15-6-5-7-17(10-15)29-30(4,24)25)20(23)21-16-11-18(27-2)13-19(12-16)28-3/h5-7,10-13H,8-9,14H2,1-4H3,(H,21,23) |
| InChIKey | LSKMNDKMWQKTJH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|