C19H24N2O6S — CID 4088813
[3-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 4088813) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is [3-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4088813 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [3-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1cccc(OS(C)(=O)=O)c1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C19H24N2O6S/c1-25-12-11-21(19(22)20-17-9-4-5-10-18(17)26-2)14-15-7-6-8-16(13-15)27-28(3,23)24/h4-10,13H,11-12,14H2,1-3H3,(H,20,22) |
| InChIKey | NZANXOKJJMCIMF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|