C25H28N2O3 — CID 42703414
3-(2-methoxyphenyl)-1-(2-methylpropyl)-1-[(3-phenoxyphenyl)methyl]urea (PubChem CID 42703414) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-(2-methylpropyl)-1-[(3-phenoxyphenyl)methyl]urea.
| Compound Name | 3-(2-methoxyphenyl)-1-(2-methylpropyl)-1-[(3-phenoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42703414 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-(2-methylpropyl)-1-[(3-phenoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1NC(=O)N(Cc1cccc(Oc2ccccc2)c1)CC(C)C |
| InChI | InChI=1S/C25H28N2O3/c1-19(2)17-27(25(28)26-23-14-7-8-15-24(23)29-3)18-20-10-9-13-22(16-20)30-21-11-5-4-6-12-21/h4-16,19H,17-18H2,1-3H3,(H,26,28) |
| InChIKey | ZVPKZNKOKKUJON-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |