C28H25FN2O2 — CID 42702973
3-(2-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]-1-(1-phenylethyl)urea (PubChem CID 42702973) has the molecular formula C28H25FN2O2 and a molecular weight of 440.52 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]-1-(1-phenylethyl)urea.
| Compound Name | 3-(2-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]-1-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 42702973 |
| Molecular Formula | C28H25FN2O2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]-1-(1-phenylethyl)urea |
| SMILES | CC(c1ccccc1)N(Cc1cccc(Oc2ccccc2)c1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C28H25FN2O2/c1-21(23-12-4-2-5-13-23)31(28(32)30-27-18-9-8-17-26(27)29)20-22-11-10-16-25(19-22)33-24-14-6-3-7-15-24/h2-19,21H,20H2,1H3,(H,30,32) |
| InChIKey | IGIOKQIFGRXOIH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |