C26H29FN2O3 — CID 42708380
1-butan-2-yl-3-(2-fluorophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea (PubChem CID 42708380) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2-fluorophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 1-butan-2-yl-3-(2-fluorophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42708380 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-butan-2-yl-3-(2-fluorophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
| SMILES | CCC(C)N(Cc1ccc(OCc2ccccc2)c(OC)c1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C26H29FN2O3/c1-4-19(2)29(26(30)28-23-13-9-8-12-22(23)27)17-21-14-15-24(25(16-21)31-3)32-18-20-10-6-5-7-11-20/h5-16,19H,4,17-18H2,1-3H3,(H,28,30) |
| InChIKey | VMWVLAOFHYGNGT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |