C31H32N2O4 — CID 3706770
3-(4-methoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1-(1-phenylethyl)urea (PubChem CID 3706770) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1-(1-phenylethyl)urea.
| Compound Name | 3-(4-methoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 3706770 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1-(1-phenylethyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccc(OC)c(OCc3ccccc3)c2)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O4/c1-23(26-12-8-5-9-13-26)33(31(34)32-27-15-17-28(35-2)18-16-27)21-25-14-19-29(36-3)30(20-25)37-22-24-10-6-4-7-11-24/h4-20,23H,21-22H2,1-3H3,(H,32,34) |
| InChIKey | IKKINYHZWVBGPB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |