C33H36N2O2 — CID 42697609
1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-(4-methoxyphenyl)urea (PubChem CID 42697609) has the molecular formula C33H36N2O2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42697609 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccc(C(C)(C)C)cc2)C(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H36N2O2/c1-33(2,3)28-17-15-26(16-18-28)24-35(32(36)34-29-19-21-30(37-4)22-20-29)31(27-13-9-6-10-14-27)23-25-11-7-5-8-12-25/h5-22,31H,23-24H2,1-4H3,(H,34,36) |
| InChIKey | JKJXCNDQHIBBKQ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |