C21H32N2O — CID 160933231
1-benzyl-3-phenyl-1-propan-2-ylurea;ethane (PubChem CID 160933231) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-benzyl-3-phenyl-1-propan-2-ylurea;ethane.
| Compound Name | 1-benzyl-3-phenyl-1-propan-2-ylurea;ethane |
|---|---|
| PubChem CID | 160933231 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 1-benzyl-3-phenyl-1-propan-2-ylurea;ethane |
| SMILES | CC.CC.CC(C)N(Cc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H20N2O.2C2H6/c1-14(2)19(13-15-9-5-3-6-10-15)17(20)18-16-11-7-4-8-12-16;2*1-2/h3-12,14H,13H2,1-2H3,(H,18,20);2*1-2H3 |
| InChIKey | STNNNGYIDMOUCT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |