C19H21ClN2O3 — CID 11792903
(2S)-2-[benzyl-[(4-chlorophenyl)carbamoyl]amino]-3-methylbutanoic acid (PubChem CID 11792903) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is (2S)-2-[benzyl-[(4-chlorophenyl)carbamoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[benzyl-[(4-chlorophenyl)carbamoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11792903 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (2S)-2-[benzyl-[(4-chlorophenyl)carbamoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(Cc1ccccc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-13(2)17(18(23)24)22(12-14-6-4-3-5-7-14)19(25)21-16-10-8-15(20)9-11-16/h3-11,13,17H,12H2,1-2H3,(H,21,25)(H,23,24)/t17-/m0/s1 |
| InChIKey | HTPREGFCIXZDHQ-KRWDZBQOSA-N |
| XLogP | 4.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |