C26H28ClN3O2 — CID 43820968
2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[4-(dimethylamino)phenyl]propanamide (PubChem CID 43820968) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 43820968 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[4-(dimethylamino)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(N(C)C)cc1)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H28ClN3O2/c1-19(26(32)28-23-13-15-24(16-14-23)29(2)3)30(18-21-9-11-22(27)12-10-21)25(31)17-20-7-5-4-6-8-20/h4-16,19H,17-18H2,1-3H3,(H,28,32) |
| InChIKey | WNQYIBGLCXDENK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|