C34H36FN3O2 — CID 43821033
N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-propan-2-ylphenyl)acetamide (PubChem CID 43821033) has the molecular formula C34H36FN3O2 and a molecular weight of 537.68 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-propan-2-ylphenyl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43821033 |
| Molecular Formula | C34H36FN3O2 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-2-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(C(C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccc(F)cc2)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36FN3O2/c1-24(2)27-12-14-28(15-13-27)33(34(40)36-30-18-20-31(21-19-30)37(3)4)38(23-26-10-16-29(35)17-11-26)32(39)22-25-8-6-5-7-9-25/h5-21,24,33H,22-23H2,1-4H3,(H,36,40) |
| InChIKey | LMRASJLMLKCLLG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|