C34H36N6O2 — CID 2722180
(2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-[4-(dimethylamino)phenyl]-2-(4-propan-2-ylphenyl)acetamide (PubChem CID 2722180) has the molecular formula C34H36N6O2 and a molecular weight of 560.70 g/mol. Its IUPAC name is (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-[4-(dimethylamino)phenyl]-2-(4-propan-2-ylphenyl)acetamide.
| Compound Name | (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-[4-(dimethylamino)phenyl]-2-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2722180 |
| Molecular Formula | C34H36N6O2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-benzylamino]-N-[4-(dimethylamino)phenyl]-2-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc([C@H](C(=O)Nc2ccc(N(C)C)cc2)N(Cc2ccccc2)C(=O)Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C34H36N6O2/c1-24(2)26-14-16-27(17-15-26)33(34(42)35-28-18-20-29(21-19-28)38(3)4)39(22-25-10-6-5-7-11-25)32(41)23-40-31-13-9-8-12-30(31)36-37-40/h5-21,24,33H,22-23H2,1-4H3,(H,35,42)/t33-/m1/s1 |
| InChIKey | CLYIALCAFFQEKI-MGBGTMOVSA-N |
| XLogP | 6.03 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|