C27H31N7O2 — CID 3587281
2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-3-methylbutanamide (PubChem CID 3587281) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-3-methylbutanamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3587281 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(pyridin-3-ylmethyl)amino]-N-[4-(dimethylamino)phenyl]-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc(N(C)C)cc1)N(Cc1cccnc1)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C27H31N7O2/c1-19(2)26(27(36)29-21-11-13-22(14-12-21)32(3)4)33(17-20-8-7-15-28-16-20)25(35)18-34-24-10-6-5-9-23(24)30-31-34/h5-16,19,26H,17-18H2,1-4H3,(H,29,36) |
| InChIKey | LPHWKWJFURCOMW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|